CAS 1196153-51-1

1,1-Dimethylethyl 3-amino-6-cyclobutyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5(1H)-carboxylate

Description:

1,1-Dimethylethyl 3-amino-6-cyclobutyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5(1H)-carboxylate, identified by its CAS number 1196153-51-1, is a chemical compound characterized by its complex structure, which includes a pyrrolo[3,4-c]pyrazole core. This compound features a dimethyl group, contributing to its steric bulk, and an amino group that may participate in hydrogen bonding and influence its reactivity. The cyclobutyl substituent adds rigidity to the molecular framework, potentially affecting its biological activity and interaction with other molecules. The carboxylate functional group suggests that it may exhibit acidic properties, which can be relevant in various chemical reactions or biological processes. Overall, the unique combination of functional groups and structural features may impart specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Further studies would be necessary to elucidate its precise behavior in biological systems and its potential applications.

Formula: C₁₄H₂₂N₄O₂

InChI: InChI=1S/C14H22N4O2/c1-14(2,3)20-13(19)18-7-9-10(16-17-12(9)15)11(18)8-5-4-6-8/h8,11H,4-7H2,1-3H3,(H3,15,16,17)

InChI key: InChIKey=LBOJKWPCGJOISL-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C(C2=C(C1)C(N)=NN2)C3CCC3

Synonyms:

• 1,1-Dimethylethyl 3-amino-6-cyclobutyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5(1H)-carboxylate
• Pyrrolo[3,4-c]pyrazole-5(1H)-carboxylic acid, 3-amino-6-cyclobutyl-4,6-dihydro-, 1,1-dimethylethyl ester