CAS 1196153-62-4

2-Ethynyl-4-methylpyrimidine

Description:

2-Ethynyl-4-methylpyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with an ethynyl group at the 2-position and a methyl group at the 4-position. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO). Its molecular structure contributes to its potential reactivity, particularly in nucleophilic substitution reactions due to the presence of the ethynyl group. The compound may also participate in various chemical transformations, making it of interest in synthetic organic chemistry and medicinal chemistry. Additionally, its unique structure allows for potential applications in the development of pharmaceuticals or agrochemicals. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken. Overall, 2-Ethynyl-4-methylpyrimidine is a valuable compound in research and industrial applications due to its distinctive properties and reactivity.

Formula: C₇H₆N₂

InChI: InChI=1S/C7H6N2/c1-3-7-8-5-4-6(2)9-7/h1,4-5H,2H3

InChI key: InChIKey=WSCRXRICHILWNN-UHFFFAOYSA-N

SMILES: C(#C)C=1N=C(C)C=CN1

Synonyms:

• 2-Ethynyl-4-methylpyrimidine
• Pyrimidine, 2-ethynyl-4-methyl-