CAS 1196153-66-8

Ethyl 2-methyl-4-(trifluoromethyl)-3-pyridinecarboxylate

Description:

Ethyl 2-methyl-4-(trifluoromethyl)-3-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a trifluoromethyl group, which is known for its strong electron-withdrawing properties, enhancing the compound's reactivity and influencing its physical properties. The ethyl ester functional group contributes to its solubility in organic solvents and its potential applications in various chemical reactions, including esterification and nucleophilic substitutions. The presence of the methyl group on the pyridine ring can affect the compound's steric and electronic properties, potentially influencing its biological activity and interactions. This compound may be of interest in pharmaceutical chemistry and agrochemical applications due to its unique structural features. Additionally, the trifluoromethyl group can impart desirable characteristics such as increased lipophilicity and metabolic stability, making it a valuable building block in the synthesis of more complex molecules.

Formula: C₁₀H₁₀F₃NO₂

InChI: InChI=1S/C10H10F3NO2/c1-3-16-9(15)8-6(2)14-5-4-7(8)10(11,12)13/h4-5H,3H2,1-2H3

InChI key: InChIKey=MRBCRGKSGMPXEJ-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C(C(F)(F)F)=CC=NC1C

Synonyms:

• Ethyl 2-methyl-4-(trifluoromethyl)-3-pyridinecarboxylate
• 3-Pyridinecarboxylic acid, 2-methyl-4-(trifluoromethyl)-, ethyl ester