CAS 1196153-85-1

Benzeneethanimidamide, 3-bromo-, hydrochloride (1:1)

Description:

Benzeneethanimidamide, 3-bromo-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a benzene ring and an ethanimidamide functional group, with a bromine atom substituted at the third position of the benzene ring. This compound exists as a hydrochloride salt, indicating that it is typically encountered in its protonated form, which enhances its solubility in polar solvents like water. The presence of the bromine substituent can influence the compound's reactivity and biological activity, potentially making it useful in various chemical syntheses or pharmaceutical applications. As a hydrochloride, it may exhibit improved stability and handling properties compared to its free base form. The compound's molecular interactions, such as hydrogen bonding and dipole-dipole interactions, are significant in determining its behavior in biological systems and its potential applications in medicinal chemistry. Safety data and handling precautions should be observed, as with any chemical substance, particularly those containing halogens or amine functionalities.

Formula: C₈H₉BrN₂·ClH

InChI: InChI=1S/C8H9BrN2.ClH/c9-7-3-1-2-6(4-7)5-8(10)11;/h1-4H,5H2,(H3,10,11);1H

InChI key: InChIKey=ACFMBOJLOMRMJJ-UHFFFAOYSA-N

SMILES: C(C(=N)N)C1=CC(Br)=CC=C1.Cl

Synonyms:

• Benzeneethanimidamide, 3-bromo-, hydrochloride (1:1)

2-(3-Bromophenyl)ethanimidamide hydrochloride

CAS: 1196153-85-1

Versatile small molecule scaffold

Formula: C₈H₁₀BrClN₂

Purity: Min. 95%

Molecular weight: 249.53 g/mol

Ref: 3D-WXB15385