CymitQuimica logo

CAS 1196153-87-3

:

2-Chloro-6-methyl-5H-pyrrolo[3,2-d]pyrimidine

Description:
2-Chloro-6-methyl-5H-pyrrolo[3,2-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the second position and a methyl group at the sixth position of the pyrrolo-pyrimidine structure influences its reactivity and potential applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The compound may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the presence of the chlorine atom. Additionally, its heterocyclic nature allows for interactions with biological targets, which could be explored for therapeutic purposes. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C7H6ClN3
InChI:InChI=1S/C7H6ClN3/c1-4-2-5-6(10-4)3-9-7(8)11-5/h2-3,10H,1H3
InChI key:InChIKey=RYXVGNFHGCVDBV-UHFFFAOYSA-N
SMILES:CC=1NC=2C(C1)=NC(Cl)=NC2
Synonyms:
  • 5H-Pyrrolo[3,2-d]pyrimidine, 2-chloro-6-methyl-
  • 2-Chloro-6-methyl-5H-pyrrolo[3,2-d]pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.