CAS 1196153-88-4

7-Bromo-2-quinolinemethanamine

Description:

7-Bromo-2-quinolinemethanamine is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the heterocyclic ring. The presence of a bromine atom at the 7-position of the quinoline ring contributes to its reactivity and potential applications in various chemical reactions. The amine functional group attached to the methylene bridge (the -CH2- group) enhances its nucleophilicity, making it useful in organic synthesis and medicinal chemistry. This compound may exhibit biological activity, potentially serving as a scaffold for drug development, particularly in targeting specific biological pathways. Its properties, such as solubility, melting point, and stability, can vary based on the surrounding environment and conditions. As with many brominated compounds, it may also exhibit unique electronic properties due to the halogen substitution. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₁₀H₉BrN₂

InChI: InChI=1S/C10H9BrN2/c11-8-3-1-7-2-4-9(6-12)13-10(7)5-8/h1-5H,6,12H2

InChI key: InChIKey=PXRZYXGLMKERJJ-UHFFFAOYSA-N

SMILES: C(N)C1=NC2=C(C=C1)C=CC(Br)=C2

Synonyms:

• 7-Bromo-2-quinolinemethanamine
• 2-Quinolinemethanamine, 7-bromo-