CAS 1196153-97-5: Ethyl 7-aminopyrazolo[1,5-a]pyrimidine-3-carboxylate

Description: Ethyl 7-aminopyrazolo[1,5-a]pyrimidine-3-carboxylate is a chemical compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates both a pyrazole and a pyrimidine ring. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of an amino group at the 7-position of the pyrazolo ring enhances its potential for biological activity, making it of interest in medicinal chemistry. The carboxylate moiety at the 3-position plays a crucial role in the compound's reactivity and interaction with biological targets. Ethyl 7-aminopyrazolo[1,5-a]pyrimidine-3-carboxylate may exhibit various pharmacological properties, including potential anti-inflammatory or anti-cancer activities, although specific biological effects would depend on further empirical studies. Its molecular structure allows for diverse synthetic modifications, which can lead to the development of derivatives with enhanced efficacy or selectivity. Overall, this compound represents a valuable scaffold in drug discovery and development, particularly in the context of targeting specific enzymes or receptors in biological systems.

Formula: C₉H₁₀N₄O₂

InChI: InChI=1S/C9H10N4O2/c1-2-15-9(14)6-5-12-13-7(10)3-4-11-8(6)13/h3-5H,2,10H2,1H3

InChI key: InChIKey=YSYFACLHRFMDES-UHFFFAOYSA-N

SMILES: O=C(OCC)C=1C=NN2C1N=CC=C2N

Synonyms:

• Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid, 7-amino-, ethyl ester
• Ethyl 7-aminopyrazolo[1,5-a]pyrimidine-3-carboxylate

Ethyl 7-aminopyrazolo[1,5-a]pyrimidine-3-carboxylate

CAS: 1196153-97-5

• Formula: C₉H₁₀N₄O₂
• Molecular weight: 206.2013

Ethyl 7-aminopyrazolo[1,5-a]pyrimidine-3-carboxylate

CAS: 1196153-97-5

• Purity: 95.0%
• Molecular weight: 206.2050018310547

Ethyl 7-Aminopyrazolo[1,5-a]pyrimidine-3-carboxylate

CAS: 1196153-97-5

Versatile small molecule scaffold

• Formula: C₉H₁₀N₄O₂
• Purity: Min. 95%
• Molecular weight: 206.2 g/mol