CAS 1196153-99-7
:6-Chlorothiazolo[5,4-b]pyridin-2-amine
Description:
6-Chlorothiazolo[5,4-b]pyridin-2-amine is a heterocyclic compound characterized by the presence of both thiazole and pyridine rings, which contribute to its unique chemical properties. The compound features a chlorine atom at the 6-position of the thiazole ring and an amino group at the 2-position of the pyridine ring. This structural arrangement imparts specific reactivity and potential biological activity, making it of interest in medicinal chemistry. The presence of the thiazole moiety often enhances the compound's ability to interact with biological targets, while the amino group can participate in hydrogen bonding and other interactions. The compound is typically synthesized through multi-step organic reactions, and its properties may include solubility in polar solvents, moderate stability under standard conditions, and potential for further derivatization. Its unique structure suggests potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. As with many heterocycles, the compound's electronic properties and steric factors can significantly influence its reactivity and interactions with other molecules.
Formula:C6H4ClN3S
InChI:InChI=1S/C6H4ClN3S/c7-3-1-4-5(9-2-3)11-6(8)10-4/h1-2H,(H2,8,10)
InChI key:InChIKey=LQGIAGSLQXLTMM-UHFFFAOYSA-N
SMILES:NC=1SC=2C(N1)=CC(Cl)=CN2
Synonyms:- Thiazolo[5,4-b]pyridin-2-amine, 6-chloro-
- [6-Chlorothiazolo[5,4-b]pyridin-2-yl]amine
- 6-Chlorothiazolo[5,4-b]pyridin-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.