CAS 1196154-04-7

2-Chloro-5-methoxythiazolo[5,4-b]pyridine

Description:

2-Chloro-5-methoxythiazolo[5,4-b]pyridine is a heterocyclic compound characterized by its thiazole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 2-position and a methoxy group at the 5-position enhances its reactivity and solubility in organic solvents. This compound typically exhibits moderate to high polarity due to the electronegative chlorine and oxygen atoms, influencing its interactions in biological systems. It may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it a potential candidate for pharmaceutical applications. Additionally, the thiazole and pyridine moieties are known for their biological activity, which may suggest potential uses in medicinal chemistry. The compound's stability and reactivity can be affected by environmental factors such as pH and temperature, and it may require specific handling and storage conditions to maintain its integrity. Overall, 2-Chloro-5-methoxythiazolo[5,4-b]pyridine represents a versatile structure with implications in both synthetic and medicinal chemistry.

Formula: C₇H₅ClN₂OS

InChI: InChI=1S/C7H5ClN2OS/c1-11-5-3-2-4-6(10-5)12-7(8)9-4/h2-3H,1H3

InChI key: InChIKey=OULPUEUXOWTDDC-UHFFFAOYSA-N

SMILES: ClC1=NC=2C(=NC(OC)=CC2)S1

Synonyms:

• Thiazolo[5,4-b]pyridine, 2-chloro-5-methoxy-
• 2-Chloro-5-methoxythiazolo[5,4-b]pyridine

2-Chloro-5-methoxy-[1,3]thiazolo[5,4-b]pyridine

CAS: 1196154-04-7

Versatile small molecule scaffold

Formula: C₇H₅ClN₂OS

Purity: Min. 95%

Molecular weight: 200.65 g/mol

Ref: 3D-WXB15404