CAS 1196154-14-9

1-(2,4-Dimethyl-5-oxazolyl)-2-propanone

Description:

1-(2,4-Dimethyl-5-oxazolyl)-2-propanone, identified by its CAS number 1196154-14-9, is an organic compound characterized by its oxazole ring structure, which contributes to its unique chemical properties. This compound features a ketone functional group, indicated by the "propanone" part of its name, which typically enhances its reactivity in various chemical reactions, particularly in nucleophilic addition and condensation reactions. The presence of the dimethyl substituents on the oxazole ring can influence its electronic properties and steric hindrance, potentially affecting its solubility and reactivity. Additionally, the compound may exhibit interesting photochemical properties, making it useful in applications such as photoinitiators in polymerization processes. Its specific characteristics, including melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.

Formula: C₈H₁₁NO₂

InChI: InChI=1S/C8H11NO2/c1-5(10)4-8-6(2)9-7(3)11-8/h4H2,1-3H3

InChI key: InChIKey=PKMSYRKAQVGLRH-UHFFFAOYSA-N

SMILES: C(C(C)=O)C=1OC(C)=NC1C

Synonyms:

• 1-(2,4-Dimethyl-5-oxazolyl)-2-propanone
• 2-Propanone, 1-(2,4-dimethyl-5-oxazolyl)-