
CAS 1196154-16-1
:2-Chloro-5-(phenylmethyl)oxazole
Description:
2-Chloro-5-(phenylmethyl)oxazole is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of a chlorine atom at the 2-position and a phenylmethyl group at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential reactivity due to the electrophilic nature of the chlorine atom, which can participate in nucleophilic substitution reactions. The phenylmethyl group can enhance the lipophilicity of the molecule, potentially influencing its biological activity and interactions. 2-Chloro-5-(phenylmethyl)oxazole may be of interest in medicinal chemistry and material science, where its derivatives could be explored for various applications, including pharmaceuticals or agrochemicals. As with many chemical substances, safety precautions should be observed when handling it, given the potential hazards associated with chlorine-containing compounds.
Formula:C10H8ClNO
InChI:InChI=1S/C10H8ClNO/c11-10-12-7-9(13-10)6-8-4-2-1-3-5-8/h1-5,7H,6H2
InChI key:InChIKey=RFWJYPIXSYQBLO-UHFFFAOYSA-N
SMILES:C(C1=CN=C(Cl)O1)C2=CC=CC=C2
Synonyms:- 2-Chloro-5-(phenylmethyl)oxazole
- Oxazole, 2-chloro-5-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.