
CAS 1196154-32-1
:1,6-Dihydro-4-hydroxy-6-oxo-3-pyridinecarboxaldehyde
Description:
1,6-Dihydro-4-hydroxy-6-oxo-3-pyridinecarboxaldehyde, identified by its CAS number 1196154-32-1, is a chemical compound that features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound is characterized by the presence of a hydroxyl group (-OH) and an aldehyde group (-CHO), contributing to its reactivity and potential biological activity. The keto group (C=O) at the 6-position enhances its electrophilic character, making it a candidate for various chemical reactions, including condensation and nucleophilic attacks. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the ability of pyridine derivatives to interact with biological targets. Additionally, the compound may exhibit properties such as antioxidant activity or antimicrobial effects, although specific biological activities would require further investigation. Overall, its unique functional groups and heterocyclic structure make it an interesting subject for research in organic synthesis and drug development.
Formula:C6H5NO3
InChI:InChI=1S/C6H5NO3/c8-3-4-2-7-6(10)1-5(4)9/h1-3H,(H2,7,9,10)
InChI key:InChIKey=WXTBDRLXIYSSON-UHFFFAOYSA-N
SMILES:C(=O)C=1C(O)=CC(=O)NC1
Synonyms:- 1,6-Dihydro-4-hydroxy-6-oxo-3-pyridinecarboxaldehyde
- 3-Pyridinecarboxaldehyde, 1,6-dihydro-4-hydroxy-6-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.