
CAS 1196154-44-5
:5-(Trifluoromethyl)-2-pyrazineethanamine
Description:
5-(Trifluoromethyl)-2-pyrazineethanamine is a chemical compound characterized by its unique structure, which includes a pyrazine ring and a trifluoromethyl group. The presence of the trifluoromethyl group significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its reactivity and biological activity. This compound is likely to exhibit polar characteristics due to the nitrogen atoms in the pyrazine ring and the amine functional group, which can participate in hydrogen bonding. It may also display interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The compound's molecular structure suggests potential applications in various fields, including agrochemicals and pharmaceuticals. Additionally, its stability and reactivity can be influenced by environmental factors, such as pH and temperature. Overall, 5-(Trifluoromethyl)-2-pyrazineethanamine is a versatile compound with properties that warrant further investigation for potential applications in chemical synthesis and drug development.
Formula:C7H8F3N3
InChI:InChI=1S/C7H8F3N3/c8-7(9,10)6-4-12-5(1-2-11)3-13-6/h3-4H,1-2,11H2
InChI key:InChIKey=LCNNQWVWQHEMRW-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=NC(CCN)=CN1
Synonyms:- 5-(Trifluoromethyl)-2-pyrazineethanamine
- 2-Pyrazineethanamine, 5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.