
CAS 1196154-73-0
:Methyl 4-amino-α-bromobenzeneacetate
Description:
Methyl 4-amino-α-bromobenzeneacetate is an organic compound characterized by its functional groups, which include an amino group and a bromine atom attached to a benzene ring. This compound features an ester functional group due to the presence of the methyl acetate moiety. The bromine substituent typically enhances the compound's reactivity, making it useful in various synthetic applications. The amino group can participate in hydrogen bonding and may influence the compound's solubility and reactivity in biological systems. Methyl 4-amino-α-bromobenzeneacetate may exhibit properties such as moderate polarity, which can affect its interactions with solvents and other chemical species. Additionally, the presence of both the amino and bromine groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks or environmental hazards.
Formula:C9H10BrNO2
InChI:InChI=1S/C9H10BrNO2/c1-13-9(12)8(10)6-2-4-7(11)5-3-6/h2-5,8H,11H2,1H3
InChI key:InChIKey=HMFVOYFBSVGWNO-UHFFFAOYSA-N
SMILES:C(C(OC)=O)(Br)C1=CC=C(N)C=C1
Synonyms:- Methyl 4-amino-α-bromobenzeneacetate
- Benzeneacetic acid, 4-amino-α-bromo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.