CymitQuimica logo

CAS 1196154-74-1

:

Octahydro-1H-pyrrolo[3,2-c]pyridine

Description:
Octahydro-1H-pyrrolo[3,2-c]pyridine is a bicyclic organic compound characterized by its unique fused ring structure, which consists of a pyrrolidine and a piperidine moiety. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The compound exhibits moderate polarity, which influences its solubility in various organic solvents. Its molecular structure contributes to its reactivity, allowing for various chemical transformations, including functionalization and ring-opening reactions. Additionally, Octahydro-1H-pyrrolo[3,2-c]pyridine may exhibit interesting biological activities, making it a subject of interest in drug discovery and development. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C7H14N2
InChI:InChI=1S/C7H14N2/c1-4-9-7-2-3-8-5-6(1)7/h6-9H,1-5H2
InChI key:InChIKey=UWQVPLPJLRBXRH-UHFFFAOYSA-N
SMILES:C12C(NCC1)CCNC2
Synonyms:
  • 3,7-Diazabicyclo[4.3.0]nonane
  • Octahydro-1H-pyrrolo[3,2-c]pyridine
  • 1H-Pyrrolo[3,2-c]pyridine, octahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.