CAS 1196154-83-2
:5,6,7,8-Tetrahydro-3-nitro-1,7-naphthyridine
Description:
5,6,7,8-Tetrahydro-3-nitro-1,7-naphthyridine is a heterocyclic organic compound characterized by its bicyclic structure, which includes a nitrogen atom in the naphthyridine ring system. This compound features a nitro group (-NO2) at the 3-position, contributing to its reactivity and potential applications in medicinal chemistry. The tetrahydro configuration indicates that the compound has four hydrogen atoms added to the naphthyridine framework, resulting in a saturated structure that can influence its physical and chemical properties, such as solubility and stability. The presence of the nitro group may also enhance its biological activity, making it a candidate for further investigation in drug development. Additionally, the compound's molecular structure suggests potential interactions with biological targets, which could be explored in pharmacological studies. Overall, 5,6,7,8-Tetrahydro-3-nitro-1,7-naphthyridine represents a class of compounds that may exhibit interesting chemical behavior and biological significance.
Formula:C8H9N3O2
InChI:InChI=1S/C8H9N3O2/c12-11(13)7-3-6-1-2-9-5-8(6)10-4-7/h3-4,9H,1-2,5H2
InChI key:InChIKey=QJKGWLHMWFVSND-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C2C(=NC1)CNCC2
Synonyms:- 1,7-Naphthyridine, 5,6,7,8-tetrahydro-3-nitro-
- 5,6,7,8-Tetrahydro-3-nitro-1,7-naphthyridine
- 3-NITRO-5,6,7,8-TETRAHYDRO-1,7-NAPHTHYRIDINE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.