CymitQuimica logo

CAS 1196154-95-6

:

5-Iodo-2-pyrazinecarbonitrile

Description:
5-Iodo-2-pyrazinecarbonitrile is a heterocyclic organic compound characterized by the presence of both a pyrazine ring and a cyano group, along with an iodine substituent. The pyrazine ring contributes to its aromatic properties, while the cyano group (-C≡N) enhances its reactivity and polarity. This compound typically appears as a crystalline solid and is soluble in polar organic solvents. Its iodine atom can participate in various chemical reactions, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of the cyano group also allows for potential applications in materials science, as it can facilitate the formation of coordination complexes. Additionally, the compound's structure suggests potential for biological activity, which may warrant further investigation in medicinal chemistry. Overall, 5-Iodo-2-pyrazinecarbonitrile is a versatile compound with significant implications in both synthetic and applied chemistry.
Formula:C5H2IN3
InChI:InChI=1S/C5H2IN3/c6-5-3-8-4(1-7)2-9-5/h2-3H
InChI key:InChIKey=UEARLISXNBMUAU-UHFFFAOYSA-N
SMILES:C(#N)C=1C=NC(I)=CN1
Synonyms:
  • 5-Iodo-2-pyrazinecarbonitrile
  • 2-Pyrazinecarbonitrile, 5-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.