CAS 1196155-60-8
:4,6-Dichloro-2-methyl-5-pyrimidinecarboxamide
Description:
4,6-Dichloro-2-methyl-5-pyrimidinecarboxamide is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of two chlorine atoms at the 4 and 6 positions of the ring contributes to its reactivity and potential biological activity. The methyl group at the 2 position and the carboxamide functional group at the 5 position further define its chemical properties. This compound is typically used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its molecular structure suggests potential applications in agrochemicals or as a building block in organic synthesis. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can exhibit toxicity and environmental persistence.
Formula:C6H5Cl2N3O
InChI:InChI=1S/C6H5Cl2N3O/c1-2-10-4(7)3(6(9)12)5(8)11-2/h1H3,(H2,9,12)
InChI key:InChIKey=FRYYNJGCIJDRDF-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1C(Cl)=NC(C)=NC1Cl
Synonyms:- 5-Pyrimidinecarboxamide, 4,6-dichloro-2-methyl-
- 4,6-Dichloro-2-methyl-5-pyrimidinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
