CAS 1196155-70-0

4-Chloro-5-methyl-2-pyridinemethanamine

Description:

4-Chloro-5-methyl-2-pyridinemethanamine, identified by its CAS number 1196155-70-0, is a chemical compound that features a pyridine ring substituted with a chlorine atom and a methyl group, along with an amine functional group. This compound is characterized by its heterocyclic structure, which contributes to its potential reactivity and biological activity. The presence of the chlorine atom typically enhances the compound's lipophilicity, potentially affecting its solubility and interaction with biological systems. The amine group can participate in hydrogen bonding, influencing its chemical behavior and reactivity. This compound may be of interest in medicinal chemistry and pharmaceutical research due to its structural features, which could lead to various biological activities. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, and it may be utilized in the development of agrochemicals or as an intermediate in the synthesis of more complex molecules. As with any chemical substance, safety data and handling precautions should be reviewed before use.

Formula: C₇H₉ClN₂

InChI: InChI=1S/C7H9ClN2/c1-5-4-10-6(3-9)2-7(5)8/h2,4H,3,9H2,1H3

InChI key: InChIKey=FDGQAOLDLLSLSD-UHFFFAOYSA-N

SMILES: C(N)C1=CC(Cl)=C(C)C=N1

Synonyms:

• 4-Chloro-5-methyl-2-pyridinemethanamine
• 2-Pyridinemethanamine, 4-chloro-5-methyl-