CAS 1196155-92-6

2-Chloro-5-(1,1-dimethylethyl)pyrazine

Description:

2-Chloro-5-(1,1-dimethylethyl)pyrazine is an organic compound characterized by its pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chlorine atom at the 2-position and a tert-butyl group at the 5-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its potential applications in the field of agrochemicals, particularly as an intermediate in the synthesis of various pesticides and herbicides. The tert-butyl group enhances its hydrophobic character, influencing its solubility and reactivity. Additionally, the chlorine substituent can affect its biological activity and stability. As with many chlorinated compounds, it may exhibit environmental persistence and potential toxicity, necessitating careful handling and assessment of its ecological impact. Overall, 2-Chloro-5-(1,1-dimethylethyl)pyrazine is a compound of interest in both synthetic chemistry and agricultural applications.

Formula: C₈H₁₁ClN₂

InChI: InChI=1S/C8H11ClN2/c1-8(2,3)6-4-11-7(9)5-10-6/h4-5H,1-3H3

InChI key: InChIKey=LXMMDWCXWMPCOQ-UHFFFAOYSA-N

SMILES: C(C)(C)(C)C=1C=NC(Cl)=CN1

Synonyms:

• Pyrazine, 2-chloro-5-(1,1-dimethylethyl)-
• 2-Chloro-5-(1,1-dimethylethyl)pyrazine