
CAS 1196155-93-7
:4-Chloro-7-methylpyrazolo[1,5-a]-1,3,5-triazine
Description:
4-Chloro-7-methylpyrazolo[1,5-a]-1,3,5-triazine is a heterocyclic compound characterized by its unique pyrazolo-triazine structure, which incorporates both pyrazole and triazine rings. This compound features a chlorine atom at the 4-position and a methyl group at the 7-position of the pyrazolo ring, contributing to its chemical reactivity and potential applications. It is typically a crystalline solid, exhibiting stability under standard conditions, although specific stability and reactivity can depend on environmental factors. The presence of the chlorine atom enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. This compound may have applications in pharmaceuticals, agrochemicals, or materials science due to its structural properties. Additionally, its synthesis often involves multi-step organic reactions, highlighting its complexity. As with many heterocycles, it may exhibit interesting biological activities, warranting further investigation into its potential uses in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H5ClN4
InChI:InChI=1S/C6H5ClN4/c1-4-2-5-8-3-9-6(7)11(5)10-4/h2-3H,1H3
InChI key:InChIKey=NGNMWSZUKPXHRU-UHFFFAOYSA-N
SMILES:ClC=1N2C(=CC(C)=N2)N=CN1
Synonyms:- Pyrazolo[1,5-a]-1,3,5-triazine, 4-chloro-7-methyl-
- 4-Chloro-7-methylpyrazolo[1,5-a]-1,3,5-triazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.