
CAS 1196156-09-8
:7,8-Dihydro-5H-pyrano[4,3-b]pyridine-4-carboxaldehyde
Description:
7,8-Dihydro-5H-pyrano[4,3-b]pyridine-4-carboxaldehyde is a heterocyclic organic compound characterized by its fused pyridine and pyran rings. This compound features a carboxaldehyde functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of both nitrogen and oxygen atoms in its structure imparts unique chemical properties, making it of interest in medicinal chemistry and material science. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The compound's structure allows for various functionalization possibilities, which can be explored for the development of pharmaceuticals or agrochemicals. Additionally, its potential biological activity may be investigated, as compounds with similar frameworks have been associated with various therapeutic effects. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices. Overall, 7,8-Dihydro-5H-pyrano[4,3-b]pyridine-4-carboxaldehyde represents a versatile scaffold for further chemical exploration.
Formula:C9H9NO2
InChI:InChI=1S/C9H9NO2/c11-5-7-1-3-10-9-2-4-12-6-8(7)9/h1,3,5H,2,4,6H2
InChI key:InChIKey=LOAMLZZNXAYZHW-UHFFFAOYSA-N
SMILES:C(=O)C1=C2C(=NC=C1)CCOC2
Synonyms:- 7,8-Dihydro-5H-pyrano[4,3-b]pyridine-4-carboxaldehyde
- 5H-Pyrano[4,3-b]pyridine-4-carboxaldehyde, 7,8-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.