CAS 1196156-31-6

5-Fluoro-2-(3-pyrrolidinyl)pyridine

Description:

5-Fluoro-2-(3-pyrrolidinyl)pyridine is a chemical compound characterized by its pyridine ring, which is substituted at the 2-position with a pyrrolidine moiety and at the 5-position with a fluorine atom. This structure contributes to its potential biological activity, particularly in medicinal chemistry, where such compounds may exhibit properties relevant to pharmacology. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, while the pyrrolidine group may influence receptor binding and activity. The compound is typically a solid at room temperature and may be soluble in organic solvents, reflecting its polar and non-polar characteristics. Its molecular interactions can be significant in drug design, particularly in targeting specific biological pathways. As with many fluorinated compounds, it may also exhibit unique reactivity and stability profiles. Safety and handling precautions are essential, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacokinetics and pharmacodynamics.

Formula: C₉H₁₁FN₂

InChI: InChI=1S/C9H11FN2/c10-8-1-2-9(12-6-8)7-3-4-11-5-7/h1-2,6-7,11H,3-5H2

InChI key: InChIKey=AKEHUTABDJVOMC-UHFFFAOYSA-N

SMILES: FC1=CC=C(N=C1)C2CCNC2

Synonyms:

• 5-Fluoro-2-(3-pyrrolidinyl)pyridine
• Pyridine, 5-fluoro-2-(3-pyrrolidinyl)-