
CAS 1196156-48-5
:4,5,6,7-Tetrahydro-2-methyl-6-(trifluoromethyl)-3H-imidazo[4,5-c]pyridine
Description:
4,5,6,7-Tetrahydro-2-methyl-6-(trifluoromethyl)-3H-imidazo[4,5-c]pyridine is a heterocyclic organic compound characterized by its bicyclic structure, which includes both an imidazole and a pyridine ring. This compound features a tetrahydro configuration, indicating that it contains a saturated ring system, and a trifluoromethyl group, which significantly influences its chemical properties and reactivity. The presence of the trifluoromethyl group typically enhances lipophilicity and can affect the compound's biological activity. The methyl group contributes to the overall stability and steric properties of the molecule. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its unique structure allows for potential interactions with biological targets, which could be explored in drug development. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of the trifluoromethyl group and the bicyclic framework, making it a subject of interest in various chemical and pharmaceutical research applications.
Formula:C8H10F3N3
InChI:InChI=1S/C8H10F3N3/c1-4-13-5-2-7(8(9,10)11)12-3-6(5)14-4/h7,12H,2-3H2,1H3,(H,13,14)
InChI key:InChIKey=JWAFHYIFMQHCOV-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1CC2=C(CN1)N=C(C)N2
Synonyms:- 3H-Imidazo[4,5-c]pyridine, 4,5,6,7-tetrahydro-2-methyl-6-(trifluoromethyl)-
- 4,5,6,7-Tetrahydro-2-methyl-6-(trifluoromethyl)-3H-imidazo[4,5-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.