CAS 1196156-57-6

1-(3,5-Dibromo-2-pyridinyl)ethanone

Description:

1-(3,5-Dibromo-2-pyridinyl)ethanone is an organic compound characterized by its pyridine ring substituted with two bromine atoms at the 3 and 5 positions, along with an ethanone functional group. This compound typically exhibits a pale to dark solid appearance, depending on its purity and form. The presence of bromine atoms contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The pyridine ring imparts basicity and aromatic stability, while the ethanone moiety introduces a carbonyl group, which can participate in further chemical transformations. This compound may be utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its unique structural features. Additionally, its properties, such as solubility and melting point, can vary based on the solvent and environmental conditions. Safety data should be consulted for handling, as halogenated compounds can pose health and environmental risks.

Formula: C₇H₅Br₂NO

InChI: InChI=1S/C7H5Br2NO/c1-4(11)7-6(9)2-5(8)3-10-7/h2-3H,1H3

InChI key: InChIKey=CWCIPDJIZAFAGI-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=C(Br)C=C(Br)C=N1

Synonyms:

• Ethanone, 1-(3,5-dibromo-2-pyridinyl)-
• 1-(3,5-Dibromo-2-pyridinyl)ethanone