CAS 1196156-70-3

3-(Dimethylamino)benzenemethanesulfonyl chloride

Description:

3-(Dimethylamino)benzenemethanesulfonyl chloride, with the CAS number 1196156-70-3, is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a benzene ring that is further substituted with a dimethylamino group. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its reactivity, particularly due to the sulfonyl chloride moiety, which can participate in nucleophilic substitution reactions, making it useful in organic synthesis, especially in the preparation of sulfonamides and other derivatives. The dimethylamino group contributes to its basicity and can influence its solubility in various solvents. Safety precautions are essential when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or moisture. Overall, 3-(Dimethylamino)benzenemethanesulfonyl chloride is a valuable reagent in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.

Formula: C₉H₁₂ClNO₂S

InChI: InChI=1S/C9H12ClNO2S/c1-11(2)9-5-3-4-8(6-9)7-14(10,12)13/h3-6H,7H2,1-2H3

InChI key: InChIKey=ITVGIMNVJLTNCV-UHFFFAOYSA-N

SMILES: C(S(Cl)(=O)=O)C1=CC(N(C)C)=CC=C1

Synonyms:

• 3-(Dimethylamino)benzenemethanesulfonyl chloride
• Benzenemethanesulfonyl chloride, 3-(dimethylamino)-