CAS 1196156-72-5: Methyl 4-chloro-1H-pyrazolo[3,4-b]pyridine-5-carboxylate
Description:Methyl 4-chloro-1H-pyrazolo[3,4-b]pyridine-5-carboxylate is a heterocyclic organic compound characterized by its pyrazolo-pyridine structure, which incorporates both a pyrazole and a pyridine ring. This compound features a methyl ester functional group, contributing to its reactivity and solubility properties. The presence of a chlorine atom at the 4-position of the pyrazole ring enhances its electrophilic character, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The compound is typically used in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. Its molecular structure allows for interactions with biological targets, which may lead to therapeutic applications. Additionally, the compound's stability and solubility in organic solvents make it suitable for various synthetic processes. Safety and handling precautions should be observed, as with many chemical substances, to mitigate any potential hazards associated with its use.
Formula:C8H6ClN3O2
InChI:InChI=1S/C8H6ClN3O2/c1-14-8(13)5-2-10-7-4(6(5)9)3-11-12-7/h2-3H,1H3,(H,10,11,12)
InChI key:InChIKey=RNZXDWDBIWTDIS-UHFFFAOYSA-N
SMILES:O=C(OC)C=1C=NC=2NN=CC2C1Cl
- Synonyms:
- 1H-Pyrazolo[3,4-b]pyridine-5-carboxylic acid, 4-chloro-, methyl ester
- Methyl 4-chloro-1H-pyrazolo[3,4-b]pyridine-5-carboxylate
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1H-Pyrazolo[3,4-b]pyridine-5-carboxylic acid, 4-chloro-, methyl ester REF: IN-DA000PCICAS: 1196156-72-5 | - - - | To inquire | Mon 14 Apr 25 |
![]() | methyl 4-chloro-2H-pyrazolo[3,4-b]pyridine-5-carboxylate REF: 10-F607617CAS: 1196156-72-5 | 98% | - - - | Discontinued product |
![]() | 4-Chloro-1H-pyrazolo[3,4-b]pyridine-5-carboxylic acid methyl ester REF: 3D-WXB15672CAS: 1196156-72-5 | Min. 95% | - - - | Discontinued product |

1H-Pyrazolo[3,4-b]pyridine-5-carboxylic acid, 4-chloro-, methyl ester
Ref: IN-DA000PCI
Undefined size | To inquire |

methyl 4-chloro-2H-pyrazolo[3,4-b]pyridine-5-carboxylate
Ref: 10-F607617
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

4-Chloro-1H-pyrazolo[3,4-b]pyridine-5-carboxylic acid methyl ester
Ref: 3D-WXB15672
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |