CymitQuimica logo

CAS 1196156-73-6

:

1-Methyl-4-piperidinemethanesulfonyl chloride

Description:
1-Methyl-4-piperidinemethanesulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. This compound features a piperidine ring, a six-membered nitrogen-containing heterocycle, which contributes to its basicity and potential for nucleophilic substitution reactions. The presence of the methyl group enhances its lipophilicity, potentially influencing its solubility and biological activity. As a sulfonyl chloride, it is typically used as a reagent in organic synthesis, particularly for the introduction of sulfonyl groups into various substrates. The compound is likely to be sensitive to moisture and should be handled with care, as it can hydrolyze to form the corresponding sulfonic acid. Its applications may extend to medicinal chemistry, where it could serve as an intermediate in the synthesis of pharmaceuticals. Safety precautions are essential when working with this compound due to its corrosive nature and potential to release toxic gases upon reaction with water or amines.
Formula:C7H14ClNO2S
InChI:InChI=1S/C7H14ClNO2S/c1-9-4-2-7(3-5-9)6-12(8,10)11/h7H,2-6H2,1H3
InChI key:InChIKey=AFYXFKSGSRVPNP-UHFFFAOYSA-N
SMILES:C(S(Cl)(=O)=O)C1CCN(C)CC1
Synonyms:
  • 1-Methyl-4-piperidinemethanesulfonyl chloride
  • 4-Piperidinemethanesulfonyl chloride, 1-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.