CymitQuimica logo

CAS 1196156-85-0

:

6,7-Dihydro-2-(trifluoromethyl)-5H-cyclopenta[b]pyridin-5-amine

Description:
6,7-Dihydro-2-(trifluoromethyl)-5H-cyclopenta[b]pyridin-5-amine is a chemical compound characterized by its unique bicyclic structure, which combines elements of both cyclopentane and pyridine. This compound features a trifluoromethyl group, which significantly influences its chemical reactivity and properties, often enhancing lipophilicity and biological activity. The presence of the amine functional group suggests potential for hydrogen bonding, making it a candidate for various chemical reactions, including nucleophilic substitutions. Its bicyclic nature may contribute to specific conformational properties, affecting its interaction with biological targets. The compound's molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to modulate biological pathways. Additionally, the trifluoromethyl group is known for imparting unique electronic properties, which can be advantageous in drug design. Overall, 6,7-Dihydro-2-(trifluoromethyl)-5H-cyclopenta[b]pyridin-5-amine represents a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C9H9F3N2
InChI:InChI=1S/C9H9F3N2/c10-9(11,12)8-4-1-5-6(13)2-3-7(5)14-8/h1,4,6H,2-3,13H2
InChI key:InChIKey=GZPFSASNOVRBBH-UHFFFAOYSA-N
SMILES:NC1C=2C(=NC(C(F)(F)F)=CC2)CC1
Synonyms:
  • 2-(Trifluoromethyl)-5H,6H,7H-cyclopenta[b]pyridin-5-amine
  • 2-(Trifluoromethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-5-amine
  • 6,7-Dihydro-2-(trifluoromethyl)-5H-cyclopenta[b]pyridin-5-amine
  • 5H-Cyclopenta[b]pyridin-5-amine, 6,7-dihydro-2-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.