CAS 1196157-09-1

5-Nitro-2-(3-pyrrolidinyl)pyridine

Description:

5-Nitro-2-(3-pyrrolidinyl)pyridine is a chemical compound characterized by its pyridine ring, which is substituted at the 2-position with a pyrrolidine group and at the 5-position with a nitro group. This structure contributes to its potential biological activity, particularly in medicinal chemistry, where such compounds may exhibit properties relevant to pharmacology. The presence of the nitro group can influence the compound's reactivity and polarity, while the pyrrolidine moiety may enhance its interaction with biological targets, such as receptors or enzymes. The compound is likely to be a solid at room temperature and may have specific solubility characteristics depending on the solvent used. Its molecular weight, melting point, and other physical properties would be determined through experimental methods. Additionally, safety data sheets would provide information on handling, toxicity, and environmental impact, which are crucial for laboratory and industrial applications. Overall, 5-Nitro-2-(3-pyrrolidinyl)pyridine represents a class of compounds that may be of interest for further research in drug development and chemical synthesis.

Formula: C₉H₁₁N₃O₂

InChI: InChI=1S/C9H11N3O2/c13-12(14)8-1-2-9(11-6-8)7-3-4-10-5-7/h1-2,6-7,10H,3-5H2

InChI key: InChIKey=DPEGZRQMNZXZKG-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=CC=C(N=C1)C2CCNC2

Synonyms:

• 5-Nitro-2-(3-pyrrolidinyl)pyridine
• Pyridine, 5-nitro-2-(3-pyrrolidinyl)-