
CAS 1196157-10-4
:Methyl 6-(4-piperidinyl)-3-pyridinecarboxylate
Description:
Methyl 6-(4-piperidinyl)-3-pyridinecarboxylate is a chemical compound characterized by its pyridine and piperidine moieties, which contribute to its potential biological activity. The structure features a methyl ester functional group, indicating it can participate in esterification reactions and may exhibit moderate polarity. This compound is likely to be a solid or liquid at room temperature, depending on its specific molecular interactions. Its piperidine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry, particularly for its possible pharmacological properties. The presence of nitrogen atoms in both the piperidine and pyridine rings may influence its solubility and reactivity, as well as its ability to form hydrogen bonds. Additionally, the compound's molecular weight and specific functional groups can affect its stability and behavior in various chemical environments. Overall, Methyl 6-(4-piperidinyl)-3-pyridinecarboxylate is a compound of interest for further research, particularly in the fields of drug development and organic synthesis.
Formula:C12H16N2O2
InChI:InChI=1S/C12H16N2O2/c1-16-12(15)10-2-3-11(14-8-10)9-4-6-13-7-5-9/h2-3,8-9,13H,4-7H2,1H3
InChI key:InChIKey=HIXOSDHRTYKVJP-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC=C(N=C1)C2CCNCC2
Synonyms:- Methyl 6-(4-piperidinyl)-3-pyridinecarboxylate
- 3-Pyridinecarboxylic acid, 6-(4-piperidinyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.