CAS 1196157-18-2
:2,2,2-Trifluoro-1-(1-isoquinolinyl)ethanone
Description:
2,2,2-Trifluoro-1-(1-isoquinolinyl)ethanone is a synthetic organic compound characterized by its unique trifluoromethyl group and isoquinoline moiety. The presence of three fluorine atoms contributes to its high electronegativity and lipophilicity, which can enhance its reactivity and solubility in organic solvents. The isoquinoline structure provides aromatic stability and can participate in various chemical reactions, making it a valuable intermediate in organic synthesis. This compound is typically used in medicinal chemistry and research applications, particularly in the development of pharmaceuticals due to its potential biological activity. Its molecular structure suggests that it may exhibit interesting properties such as antimicrobial or anticancer activities, although specific biological data would need to be evaluated. Additionally, the trifluoroacetyl functional group may influence its interaction with biological targets, potentially affecting its pharmacokinetics and dynamics. As with many fluorinated compounds, safety and handling precautions are essential due to the potential toxicity associated with fluorinated organic compounds.
Formula:C11H6F3NO
InChI:InChI=1S/C11H6F3NO/c12-11(13,14)10(16)9-8-4-2-1-3-7(8)5-6-15-9/h1-6H
InChI key:InChIKey=ZSRLVMSVTQXUHK-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C=1C2=C(C=CN1)C=CC=C2
Synonyms:- 2,2,2-Trifluoro-1-(1-isoquinolinyl)ethanone
- Ethanone, 2,2,2-trifluoro-1-(1-isoquinolinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
