CymitQuimica logo

CAS 1196157-27-3

:

2,4-Dichloro-6-methyl-5H-pyrrolo[3,2-d]pyrimidine

Description:
2,4-Dichloro-6-methyl-5H-pyrrolo[3,2-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings, which contribute to its unique chemical properties. The presence of two chlorine atoms at the 2 and 4 positions and a methyl group at the 6 position enhances its reactivity and solubility in various organic solvents. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of multiple functional groups that can participate in chemical reactions. Additionally, the compound may exhibit biological activity, making it of interest for further research in drug discovery. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 2,4-Dichloro-6-methyl-5H-pyrrolo[3,2-d]pyrimidine represents a significant class of compounds with diverse applications in chemical and pharmaceutical research.
Formula:C7H5Cl2N3
InChI:InChI=1S/C7H5Cl2N3/c1-3-2-4-5(10-3)6(8)12-7(9)11-4/h2,10H,1H3
InChI key:InChIKey=WXFDPWLIEMUJRE-UHFFFAOYSA-N
SMILES:ClC1=C2C(C=C(C)N2)=NC(Cl)=N1
Synonyms:
  • 5H-Pyrrolo[3,2-d]pyrimidine, 2,4-dichloro-6-methyl-
  • 2,4-Dichloro-6-methyl-5H-pyrrolo[3,2-d]pyrimidine
Found 4 products.