CAS 1196157-33-1

Ethyl 4-hydroxy-5-nitro-2-pyridinecarboxylate

Description:

Ethyl 4-hydroxy-5-nitro-2-pyridinecarboxylate, identified by its CAS number 1196157-33-1, is a chemical compound that features a pyridine ring substituted with a hydroxyl group and a nitro group, along with an ethyl ester functional group. This compound is characterized by its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to the presence of the nitro and hydroxyl groups, which can influence biological activity. The molecular structure suggests it may exhibit properties such as solubility in organic solvents and moderate stability under standard conditions. The presence of the nitro group typically imparts unique reactivity, making it a candidate for further chemical modifications. Additionally, the compound's pyridine framework is known for its ability to participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Overall, Ethyl 4-hydroxy-5-nitro-2-pyridinecarboxylate is a versatile compound with potential significance in synthetic organic chemistry and drug development.

Formula: C₈H₈N₂O₅

InChI: InChI=1S/C8H8N2O5/c1-2-15-8(12)5-3-7(11)6(4-9-5)10(13)14/h3-4H,2H2,1H3,(H,9,11)

InChI key: InChIKey=IJTSHWRWUFYLGW-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=CC(O)=C(N(=O)=O)C=N1

Synonyms:

• Ethyl 4-hydroxy-5-nitro-2-pyridinecarboxylate
• 2-Pyridinecarboxylic acid, 4-hydroxy-5-nitro-, ethyl ester