CAS 1196157-36-4

4(1H)-Isoquinolinone, 2,3-dihydro-, hydrochloride (1:1)

Description:

4(1H)-Isoquinolinone, 2,3-dihydro-, hydrochloride (1:1) is a chemical compound characterized by its isoquinolinone structure, which features a bicyclic aromatic system. This compound typically exists as a hydrochloride salt, enhancing its solubility in water and making it more suitable for various applications, particularly in biological and pharmaceutical contexts. The dihydro form indicates the presence of additional hydrogen atoms, which can influence its reactivity and stability. The compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or as a research tool in medicinal chemistry. Its molecular properties, such as melting point, boiling point, and spectral characteristics, can vary based on the specific conditions and purity of the sample. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use. Overall, this compound represents a significant interest in the field of organic and medicinal chemistry.

Formula: C₉H₉NO·ClH

InChI: InChI=1S/C9H9NO.ClH/c11-9-6-10-5-7-3-1-2-4-8(7)9;/h1-4,10H,5-6H2;1H

InChI key: InChIKey=VNCCUBVUYXYGLR-UHFFFAOYSA-N

SMILES: O=C1C=2C(CNC1)=CC=CC2.Cl

Synonyms:

• 4(1H)-Isoquinolinone, 2,3-dihydro-, hydrochloride (1:1)

2,3-Dihydroisoquinolin-4(1H)-one hydrochloride

CAS: 1196157-36-4

Formula: C₉H₁₀ClNO

Molecular weight: 183.6348

Ref: IN-DA000PDA

2,3-Dihydroisoquinolin-4(1H)-one hydrochloride

CAS: 1196157-36-4

Formula: C₉H₁₀ClNO

Purity: 95.0%

Molecular weight: 183.64

Ref: 10-F338662