
CAS 1196157-41-1: 2-Chloro-6-(trifluoromethyl)-4-pyridinemethanol
Description:2-Chloro-6-(trifluoromethyl)-4-pyridinemethanol is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro group at the 2-position and a trifluoromethyl group at the 6-position significantly influences its chemical properties, including its reactivity and polarity. The hydroxymethyl group at the 4-position introduces a functional group that can participate in hydrogen bonding, enhancing its solubility in polar solvents. This compound is typically used in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its trifluoromethyl group is particularly notable for imparting unique electronic properties, making it a valuable moiety in medicinal chemistry. Additionally, the presence of chlorine can affect the compound's biological activity and environmental stability. Overall, 2-Chloro-6-(trifluoromethyl)-4-pyridinemethanol exhibits a combination of aromaticity, halogenation, and functionalization that contributes to its utility in chemical applications.
Formula:C7H5ClF3NO
InChI:InChI=1S/C7H5ClF3NO/c8-6-2-4(3-13)1-5(12-6)7(9,10)11/h1-2,13H,3H2
InChI key:InChIKey=ZFHFVKOYKPAGNL-UHFFFAOYSA-N
SMILES:FC(F)(F)C1=NC(Cl)=CC(=C1)CO
- Synonyms:
- [2-Chloro-6-(trifluoromethyl)pyridin-4-yl]methanol
- 2-Chloro-6-(trifluoromethyl)-4-pyridinemethanol
- 4-Pyridinemethanol, 2-chloro-6-(trifluoromethyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-Pyridinemethanol, 2-chloro-6-(trifluoromethyl)- REF: IN-DA000PD8CAS: 1196157-41-1 | 95% | To inquire | Wed 26 Mar 25 |
![]() | [2-Chloro-6-(trifluoromethyl)pyridin-4-yl]methanol REF: 3D-WXB15741CAS: 1196157-41-1 | Min. 95% | 206.00 €~1,834.00 € | Wed 07 May 25 |
![]() | (2-Chloro-6-trifluoromethyl-pyridin-4-yl)-methanol REF: 10-F631741CAS: 1196157-41-1 | 95+% | - - - | Discontinued product |

4-Pyridinemethanol, 2-chloro-6-(trifluoromethyl)-
Ref: IN-DA000PD8
1g | To inquire | ||
500mg | To inquire |

[2-Chloro-6-(trifluoromethyl)pyridin-4-yl]methanol
Ref: 3D-WXB15741
50mg | 518.00 € | ||
500mg | 1,417.00 € |

(2-Chloro-6-trifluoromethyl-pyridin-4-yl)-methanol
Ref: 10-F631741
1g | Discontinued | Request information | |
500mg | Discontinued | Request information |