CAS 1196157-48-8

4-(Bromomethyl)-3-fluorobenzenamine

Description:

4-(Bromomethyl)-3-fluorobenzenamine is an organic compound characterized by the presence of a bromomethyl group and a fluorine atom attached to a benzene ring that also bears an amino group. This compound features a bromine atom, which is a halogen, contributing to its reactivity, particularly in nucleophilic substitution reactions. The fluorine atom introduces additional polarity and can influence the compound's electronic properties, potentially enhancing its reactivity in certain chemical environments. The amino group (-NH2) is a basic functional group that can participate in hydrogen bonding and can also act as a nucleophile. The presence of these functional groups suggests that 4-(Bromomethyl)-3-fluorobenzenamine may be useful in various synthetic applications, including the development of pharmaceuticals or agrochemicals. Its molecular structure indicates that it may exhibit moderate to high solubility in polar solvents, while its reactivity can be influenced by the steric and electronic effects of the substituents on the benzene ring. Overall, this compound's unique combination of functional groups makes it a valuable candidate for further chemical exploration.

Formula: C₇H₇BrFN

InChI: InChI=1S/C7H7BrFN/c8-4-5-1-2-6(10)3-7(5)9/h1-3H,4,10H2

InChI key: InChIKey=OQWOAAVGYYGQGV-UHFFFAOYSA-N

SMILES: C(Br)C1=C(F)C=C(N)C=C1

Synonyms:

• Benzenamine, 4-(bromomethyl)-3-fluoro-
• 4-(Bromomethyl)-3-fluorobenzenamine