CAS 1196157-53-5

1-(4-Hydroxy-2-pyridinyl)ethanone

Description:

1-(4-Hydroxy-2-pyridinyl)ethanone, also known as 4-Hydroxy-2-pyridinylacetone, is an organic compound characterized by its pyridine ring and a hydroxyl group attached to the aromatic system. This compound features a ketone functional group, which contributes to its reactivity and potential applications in various chemical reactions. The presence of the hydroxyl group enhances its solubility in polar solvents and may influence its biological activity, making it of interest in medicinal chemistry. The molecular structure allows for hydrogen bonding, which can affect its interaction with other molecules. This compound may exhibit properties such as antioxidant activity or serve as a precursor in the synthesis of more complex organic molecules. Its CAS number, 1196157-53-5, is a unique identifier that facilitates the search for information regarding its properties, safety data, and potential applications in research and industry. Overall, 1-(4-Hydroxy-2-pyridinyl)ethanone is a versatile compound with potential implications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₇H₇NO₂

InChI: InChI=1S/C7H7NO2/c1-5(9)7-4-6(10)2-3-8-7/h2-4H,1H3,(H,8,10)

InChI key: InChIKey=HEVPULHXFLAWOB-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=CC(O)=CC=N1

Synonyms:

• Ethanone, 1-(4-hydroxy-2-pyridinyl)-
• 1-(4-Hydroxy-2-pyridinyl)ethanone