
CAS 1196157-54-6
:1,1-Dimethylethyl 4-cyano-2-methyl-3-oxo-1-pyrrolidinecarboxylate
Description:
1,1-Dimethylethyl 4-cyano-2-methyl-3-oxo-1-pyrrolidinecarboxylate, identified by its CAS number 1196157-54-6, is a chemical compound characterized by its pyrrolidine structure, which includes a cyano group and a carboxylate moiety. This compound features a tert-butyl group (1,1-dimethylethyl) that contributes to its steric bulk, influencing its reactivity and solubility. The presence of the cyano group indicates potential for nucleophilic reactions, while the carbonyl functionality (3-oxo) suggests it may participate in condensation reactions or serve as a precursor for further synthetic transformations. The compound's molecular structure implies it may exhibit interesting biological activities, making it a candidate for pharmaceutical applications. Additionally, its stability and reactivity can be influenced by the surrounding functional groups, which may affect its interactions in various chemical environments. Overall, this compound represents a unique combination of features that could be explored in synthetic chemistry and drug development.
Formula:C11H16N2O3
InChI:InChI=1S/C11H16N2O3/c1-7-9(14)8(5-12)6-13(7)10(15)16-11(2,3)4/h7-8H,6H2,1-4H3
InChI key:InChIKey=SAGXHNJYGHDMQI-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC(C#N)C(=O)C1C
Synonyms:- 1,1-Dimethylethyl 4-cyano-2-methyl-3-oxo-1-pyrrolidinecarboxylate
- 1-Pyrrolidinecarboxylic acid, 4-cyano-2-methyl-3-oxo-, 1,1-dimethylethyl ester
- N-tert-Butoxycarbonyl-4-cyano-2-methyl-3-oxopyrrolidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.