
CAS 1196157-86-4
:2,6-Bis(2,2-dimethylpropyl)benzenamine
Description:
2,6-Bis(2,2-dimethylpropyl)benzenamine, identified by its CAS number 1196157-86-4, is an organic compound characterized by its amine functional group and a biphenyl structure. This substance features a benzene ring substituted at the 2 and 6 positions with two 2,2-dimethylpropyl groups, which contribute to its steric bulk and hydrophobic nature. The presence of the amine group imparts basicity and potential reactivity, making it useful in various chemical applications, including as a building block in organic synthesis or as an intermediate in the production of dyes, pharmaceuticals, or agrochemicals. Its bulky substituents may influence its solubility and melting point, typically rendering it less soluble in polar solvents. Additionally, the compound's structure suggests potential applications in materials science, particularly in the development of polymers or surfactants. Safety data should be consulted for handling and exposure guidelines, as amines can exhibit varying degrees of toxicity and reactivity.
Formula:C16H27N
InChI:InChI=1S/C16H27N/c1-15(2,3)10-12-8-7-9-13(14(12)17)11-16(4,5)6/h7-9H,10-11,17H2,1-6H3
InChI key:InChIKey=MVMYJQKKCVQHEN-UHFFFAOYSA-N
SMILES:C(C(C)(C)C)C1=C(N)C(CC(C)(C)C)=CC=C1
Synonyms:- 2,6-Bis(2,2-dimethylpropyl)benzenamine
- Benzenamine, 2,6-bis(2,2-dimethylpropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
