CAS 119626-08-3

Methyl 2-[(chlorocarbonyl)(methyl)amino]acetate

Description:

Methyl 2-[(chlorocarbonyl)(methyl)amino]acetate, identified by its CAS number 119626-08-3, is an organic compound characterized by the presence of both an ester and an amine functional group. It features a methyl ester group, which contributes to its solubility in organic solvents and its reactivity in various chemical reactions. The chlorocarbonyl group indicates the presence of a chlorine atom bonded to a carbonyl, making it a potential electrophile in nucleophilic substitution reactions. This compound is likely to exhibit moderate to high reactivity due to the electrophilic nature of the chlorocarbonyl moiety, which can participate in acylation reactions. Additionally, the methyl amino group suggests that it may engage in hydrogen bonding, influencing its physical properties such as boiling point and solubility. Overall, Methyl 2-[(chlorocarbonyl)(methyl)amino]acetate is a versatile compound that may be utilized in synthetic organic chemistry, particularly in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound due to its reactive functional groups.

Formula: C₅H₈ClNO₃

InChI: InChI=1S/C5H8ClNO3/c1-7(5(6)9)3-4(8)10-2/h3H2,1-2H3

InChI key: InChIKey=BCFMQABJWVSRLR-UHFFFAOYSA-N

SMILES: C(N(C(Cl)=O)C)C(OC)=O

Synonyms:

• Methyl 2-[(chlorocarbonyl)(methyl)amino]acetate
• Glycine, N-(chlorocarbonyl)-N-methyl-, methyl ester