CymitQuimica logo

CAS 119628-82-9

:

2-Cyclobutyl-3H-imidazo[4,5-b]pyridine

Description:
2-Cyclobutyl-3H-imidazo[4,5-b]pyridine is a heterocyclic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of the cyclobutyl group enhances its structural complexity and can influence its reactivity and interaction with biological targets. This compound typically exhibits a planar structure due to the aromatic nature of the rings, which can facilitate π-π stacking interactions. It is often studied for its potential pharmacological applications, particularly in the field of medicinal chemistry, where such heterocycles are known to exhibit diverse biological activities. The compound's solubility, stability, and reactivity can vary based on the substituents and the overall molecular conformation. Additionally, its CAS number, 119628-82-9, allows for easy identification in chemical databases, aiding in research and development efforts. Overall, 2-Cyclobutyl-3H-imidazo[4,5-b]pyridine represents a significant class of compounds with potential applications in drug discovery and development.
Formula:C10H11N3
InChI:InChI=1S/C10H11N3/c1-3-7(4-1)9-12-8-5-2-6-11-10(8)13-9/h2,5-7H,1,3-4H2,(H,11,12,13)
InChI key:InChIKey=RLGOSJYCPKFNAU-UHFFFAOYSA-N
SMILES:C=1(NC=2C(N1)=NC=CC2)C3CCC3
Synonyms:
  • 1H-Imidazo[4,5-b]pyridine, 2-cyclobutyl-
  • 2-Cyclobutyl-1H-imidazo[4,5-b]pyridine
  • 3H-Imidazo[4,5-b]pyridine, 2-cyclobutyl-
  • 2-Cyclobutyl-3H-imidazo[4,5-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.