CAS 1196395-85-3
:4,4,5,5-Tetramethyl-2-[4-phenoxy-2-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane
Description:
4,4,5,5-Tetramethyl-2-[4-phenoxy-2-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique dioxaborolane structure, which features a five-membered ring containing boron and oxygen atoms. This compound exhibits significant stability due to the presence of bulky tetramethyl groups that hinder steric interactions. The phenoxy and trifluoromethoxy substituents contribute to its chemical reactivity and solubility properties, making it potentially useful in various applications, including organic synthesis and materials science. The trifluoromethoxy group enhances the compound's electron-withdrawing characteristics, which can influence its reactivity in nucleophilic substitution reactions. Additionally, the presence of boron in the structure suggests potential applications in catalysis and as a reagent in organic transformations. Overall, this compound's distinctive structural features and functional groups make it an interesting subject for further research in the fields of organic chemistry and materials development.
Formula:C19H20BF3O4
InChI:InChI=1S/C19H20BF3O4/c1-17(2)18(3,4)27-20(26-17)15-11-10-14(12-16(15)25-19(21,22)23)24-13-8-6-5-7-9-13/h5-12H,1-4H3
InChI key:InChIKey=UKWWUBSEEAUULO-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=C(B2OC(C)(C)C(C)(C)O2)C=CC(OC3=CC=CC=C3)=C1
Synonyms:- 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[4-phenoxy-2-(trifluoromethoxy)phenyl]-
- 4,4,5,5-Tetramethyl-2-[4-phenoxy-2-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.