CAS 119644-23-4: 2′,3′-Dideoxy-3′-fluoro-5-iodouridine
Description:2′,3′-Dideoxy-3′-fluoro-5-iodouridine is a synthetic nucleoside analog that exhibits unique characteristics due to its structural modifications. This compound features a fluorine atom at the 3' position and an iodine atom at the 5' position of the uridine base, which alters its biochemical properties and enhances its potential as an antiviral agent. The presence of the dideoxy group at the 2' and 3' positions prevents the formation of a phosphodiester bond, thereby inhibiting further nucleotide incorporation during nucleic acid synthesis. This mechanism makes it a valuable tool in antiviral research, particularly against retroviruses like HIV. Additionally, the halogen substitutions can influence the compound's stability, solubility, and interaction with viral enzymes. Its unique structure allows for potential applications in therapeutic settings, particularly in the development of antiviral drugs. However, further studies are necessary to fully understand its pharmacokinetics, efficacy, and safety profile in clinical applications.
Formula:C9H10FIN2O4
InChI:InChI=1S/C9H10FIN2O4/c10-4-1-7(17-6(4)3-14)13-2-5(11)8(15)12-9(13)16/h2,4,6-7,14H,1,3H2,(H,12,15,16)/t4-,6+,7+/m0/s1
InChI key:InChIKey=FKHGYIRFPRYMOH-UBKIQSJTSA-N
SMILES:O=C1NC(=O)N(C=C1I)C2OC(CO)C(F)C2
- Synonyms:
- 1-(2,3-dideoxy-3-fluoropentofuranosyl)-5-iodopyrimidine-2,4(1H,3H)-dione
- 2',3'-Dideoxy-3'-Fluoro-5-Iodouridine
- 2′,3′-Dideoxy-3′-fluoro-5-iodouridine
- Dre 368
- Fddiurd
- Uridine, 2',3'-dideoxy-3'-fluoro-5-iodo-
- Uridine, 2′,3′-dideoxy-3′-fluoro-5-iodo-
- 3'-Fluoro-2',3'-dideoxy-5-iodouridine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Uridine, 2',3'-dideoxy-3'-fluoro-5-iodo- REF: IN-DA000PDUCAS: 119644-23-4 | - - - | To inquire | Tue 15 Apr 25 |
![]() | 3'-Fluoro-2',3'-Dideoxy-5-Iodouridine REF: 3D-FF83612CAS: 119644-23-4 | Min. 95% | - - - | Discontinued product |

3'-Fluoro-2',3'-Dideoxy-5-Iodouridine
Ref: 3D-FF83612
Undefined size | Discontinued | Request information |