CAS 119647-70-0

Ethyl 5-acetyl-1H-pyrrole-2-carboxylate

Description:

Ethyl 5-acetyl-1H-pyrrole-2-carboxylate is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features an ethyl ester functional group, an acetyl group, and a carboxylate moiety, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the acetyl group suggests that it may participate in various chemical reactions, such as acylation or condensation reactions. Ethyl 5-acetyl-1H-pyrrole-2-carboxylate may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility in organic solvents and moderate stability under standard conditions make it suitable for various laboratory applications. However, as with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.

Formula: C₉H₁₁NO₃

InChI: InChI=1S/C9H11NO3/c1-3-13-9(12)8-5-4-7(10-8)6(2)11/h4-5,10H,3H2,1-2H3

InChI key: InChIKey=UMAGGVUZZDOQKV-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1NC(C(C)=O)=CC1

Synonyms:

• 1H-Pyrrole-2-carboxylic acid, 5-acetyl-, ethyl ester
• Ethyl 5-acetyl-1H-pyrrole-2-carboxylate