CymitQuimica logo

CAS 1196486-71-1

:

4-[3-(1-Methylethyl)-1,2,4-oxadiazol-5-yl]cyclohexanone

Description:
4-[3-(1-Methylethyl)-1,2,4-oxadiazol-5-yl]cyclohexanone is a chemical compound characterized by its unique structure, which includes a cyclohexanone moiety and an oxadiazole ring. The presence of the oxadiazole group contributes to its potential biological activity, as oxadiazoles are known for their diverse pharmacological properties. The compound features a branched alkyl group (1-methylethyl) that may influence its solubility and reactivity. Typically, compounds like this may exhibit properties such as moderate to high lipophilicity due to the cyclohexanone and alkyl substituents, which can affect their interaction with biological membranes. The specific arrangement of atoms and functional groups can also lead to interesting chemical reactivity, making it a candidate for various synthetic applications or as a potential lead in drug discovery. However, detailed studies would be necessary to fully elucidate its physical and chemical properties, as well as its potential applications in medicinal chemistry or materials science.
Formula:C11H16N2O2
InChI:InChI=1S/C11H16N2O2/c1-7(2)10-12-11(15-13-10)8-3-5-9(14)6-4-8/h7-8H,3-6H2,1-2H3
InChI key:InChIKey=LFQDPAZVUVYPEW-UHFFFAOYSA-N
SMILES:C(C)(C)C=1N=C(ON1)C2CCC(=O)CC2
Synonyms:
  • 4-[3-(1-Methylethyl)-1,2,4-oxadiazol-5-yl]cyclohexanone
  • Cyclohexanone, 4-[3-(1-methylethyl)-1,2,4-oxadiazol-5-yl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.