
CAS 119650-45-2
:2-Iodo-3-methoxy-5-methylbenzenemethanol
Description:
2-Iodo-3-methoxy-5-methylbenzenemethanol, with the CAS number 119650-45-2, is an organic compound that belongs to the class of substituted phenols. This compound features a benzene ring substituted with an iodine atom, a methoxy group, and a methyl group, along with a hydroxymethyl group attached to the aromatic system. The presence of the iodine atom contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The methoxy group enhances its solubility in organic solvents and can influence its electronic properties, while the methyl group can affect steric hindrance and overall molecular stability. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structural characteristics suggest potential applications in synthesis and as an intermediate in the production of more complex organic molecules. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact.
Formula:C9H11IO2
InChI:InChI=1S/C9H11IO2/c1-6-3-7(5-11)9(10)8(4-6)12-2/h3-4,11H,5H2,1-2H3
InChI key:InChIKey=XJQLATKVZYCYAC-UHFFFAOYSA-N
SMILES:C(O)C1=C(I)C(OC)=CC(C)=C1
Synonyms:- Benzenemethanol, 2-iodo-3-methoxy-5-methyl-
- (2-Iodo-3-methoxy-5-methylphenyl)methanol
- 2-Iodo-3-methoxy-5-methylbenzenemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
