CymitQuimica logo

CAS 1196507-58-0

:

4-Chloro-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine

Description:
4-Chloro-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which features a fused pyrrole and pyridine ring system. The presence of a chloro group and a trifluoromethyl group significantly influences its chemical properties, enhancing its reactivity and lipophilicity. This compound is typically a solid at room temperature and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. Its trifluoromethyl group can enhance metabolic stability and bioactivity, making it a valuable scaffold in drug design. Additionally, the compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the trifluoromethyl group, which can affect its reactivity in various chemical reactions. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 4-Chloro-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine is a compound of interest in both synthetic and medicinal chemistry.
Formula:C8H4ClF3N2
InChI:InChI=1S/C8H4ClF3N2/c9-6-4-1-2-13-7(4)14-3-5(6)8(10,11)12/h1-3H,(H,13,14)
InChI key:InChIKey=ATLADCFKPSZUNL-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C(Cl)=C2C(=NC1)NC=C2
Synonyms:
  • 4-Chloro-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine
  • 1H-Pyrrolo[2,3-b]pyridine, 4-chloro-5-(trifluoromethyl)-
Found 4 products.