CAS 1196532-94-1

Methyl 4-(methylsulfonyl)benzenecarboximidate

Description:

Methyl 4-(methylsulfonyl)benzenecarboximidate is a chemical compound characterized by its functional groups, which include a carboximidate and a methylsulfonyl moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, reflecting its non-polar characteristics, while its polar functional groups may impart some degree of solubility in polar solvents. The presence of the methylsulfonyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to influence biological activity and solubility. The compound may exhibit reactivity typical of carboximidates, such as nucleophilic substitution or condensation reactions, making it useful in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, Methyl 4-(methylsulfonyl)benzenecarboximidate is a versatile compound with potential applications in various fields of chemistry.

Formula: C₉H₁₁NO₃S

InChI: InChI=1S/C9H11NO3S/c1-13-9(10)7-3-5-8(6-4-7)14(2,11)12/h3-6,10H,1-2H3

InChI key: InChIKey=RIZGXVDWDHHGMB-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)C1=CC=C(C(OC)=N)C=C1

Synonyms:

• Benzenecarboximidic acid, 4-(methylsulfonyl)-, methyl ester
• Methyl 4-(methylsulfonyl)benzenecarboximidate