CAS 1196723-95-1

N-[1,3-Bis(4-chlorophenyl)-1H-pyrazol-5-yl]-4-butylbenzamide

Description:

N-[1,3-Bis(4-chlorophenyl)-1H-pyrazol-5-yl]-4-butylbenzamide is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrazole ring and multiple aromatic substituents. The presence of two 4-chlorophenyl groups contributes to its potential biological activity, as chlorinated aromatic compounds often exhibit significant pharmacological properties. The butylbenzamide moiety enhances lipophilicity, which may influence the compound's solubility and permeability in biological systems. This compound is likely to be studied for its potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific interactions with biological targets would depend on the arrangement of functional groups and the overall three-dimensional conformation. As with many synthetic compounds, safety and toxicity profiles would need to be evaluated through rigorous testing. Overall, N-[1,3-Bis(4-chlorophenyl)-1H-pyrazol-5-yl]-4-butylbenzamide represents a class of compounds that may hold promise in drug discovery and development.

Formula: C₂₆H₂₃Cl₂N₃O

InChI: InChI=1S/C26H23Cl2N3O/c1-2-3-4-18-5-7-20(8-6-18)26(32)29-25-17-24(19-9-11-21(27)12-10-19)30-31(25)23-15-13-22(28)14-16-23/h5-17H,2-4H2,1H3,(H,29,32)

InChI key: InChIKey=YBESODXFBCCIIN-UHFFFAOYSA-N

SMILES: N(C(=O)C1=CC=C(CCCC)C=C1)C=2N(N=C(C2)C3=CC=C(Cl)C=C3)C4=CC=C(Cl)C=C4

Synonyms:

• N-[1,3-Bis(4-chlorophenyl)-1H-pyrazol-5-yl]-4-butylbenzamide
• Benzamide, N-[1,3-bis(4-chlorophenyl)-1H-pyrazol-5-yl]-4-butyl-

3-(N-Methylpyrrolidin-2-ylmethyl)-5-(3-nitropyrid-2-ylamino)-1H-indole

CAS: 1196723-95-1

3-(N-Methylpyrrolidin-2-ylmethyl)-5-(3-nitropyrid-2-ylamino)-1H-indole is a synthetic compound that serves as a potential pharmacological agent. It is derived through chemical synthesis, primarily involving the coupling of various functional groups designed to optimize its interaction with specific biological targets. The mode of action of this compound involves binding to particular receptors or enzymes in biological systems, inducing a consequential biochemical response.

Formula: C₁₉H₂₁N₅O₂

Purity: Min. 95%

Molecular weight: 351.4 g/mol

Ref: 3D-WXB72395